The synonyms are 2-(4-methoxyphenyl)-N-[4-(prop-2-en-1-yloxy)benzyl]ethanamine, 2-(4-methoxyphenyl)-N-[(4-prop-2-enoxyphenyl)methyl]ethanamine, AKOS001477171, NCGC00326559-01, AB01321373-02, and more.
When was the compound created?
The compound was created on September 16, 2005.
What is the molecular weight of the compound?
The molecular weight is 297.4 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is 2-(4-methoxyphenyl)-N-[(4-prop-2-enoxyphenyl)methyl]ethanamine.
What is the InChI of the compound?
The InChI is InChI=1S/C19H23NO2/c1-3-14-22-19-10-6-17(7-11-19)15-20-13-12-16-4-8-18(21-2)9-5-16/h3-11,20H,1,12-15H2,2H3.
What is the InChIKey of the compound?
The InChIKey is HSFBIGHNZDCYNM-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is COC1=CC=C(C=C1)CCNCC2=CC=C(C=C2)OCC=C.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value is 3.8.
How many hydrogen bond acceptor count does the compound have?
The compound has 3 hydrogen bond acceptor count.
※ Please kindly note that our products are for research use only.