What is the molecular formula of Methylazoxymethanol?
The molecular formula of Methylazoxymethanol is C2H6N2O2.
What is the molecular weight of Methylazoxymethanol?
The molecular weight of Methylazoxymethanol is 90.08 g/mol.
What is the IUPAC name of Methylazoxymethanol?
The IUPAC name of Methylazoxymethanol is (Z)-hydroxymethylimino-methyl-oxidoazanium.
What is the InChI of Methylazoxymethanol?
The InChI of Methylazoxymethanol is InChI=1S/C2H6N2O2/c1-4(6)3-2-5/h5H,2H2,1H3/b4-3-.
What is the InChIKey of Methylazoxymethanol?
The InChIKey of Methylazoxymethanol is BJNBRIBHKLJMAG-ARJAWSKDSA-N.
What is the canonical SMILES of Methylazoxymethanol?
The canonical SMILES of Methylazoxymethanol is C[N+](=NCO)[O-].
How many hydrogen bond donor counts does Methylazoxymethanol have?
Methylazoxymethanol has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Methylazoxymethanol have?
Methylazoxymethanol has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of Methylazoxymethanol?
The topological polar surface area of Methylazoxymethanol is 61.3.
Is Methylazoxymethanol a canonicalized compound?
Yes, Methylazoxymethanol is a canonicalized compound.