CAS
--- Purity
---
--- Purity
---
Shopping basket
Methylaminoformyl chloride
Catalog Number
ACMA00001300
Category
Amines
Molecular Weight
93.51
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H315-H319-H335
RIDADR
UN 2733PSN1 8(3) / PGII
Symbol
GHS07
What is the molecular formula of Methylaminoformyl chloride?
The molecular formula of Methylaminoformyl chloride is C2H4ClNO.
What is the molecular weight of Methylaminoformyl chloride?
The molecular weight of Methylaminoformyl chloride is 93.51 g/mol.
What is the IUPAC name of Methylaminoformyl chloride?
The IUPAC name of Methylaminoformyl chloride is N-methylcarbamoyl chloride.
What is the InChI of Methylaminoformyl chloride?
The InChI of Methylaminoformyl chloride is InChI=1S/C2H4ClNO/c1-4-2(3)5/h1H3,(H,4,5).
What is the InChIKey of Methylaminoformyl chloride?
The InChIKey of Methylaminoformyl chloride is GRRYSIXDUIAUGY-UHFFFAOYSA-N.
What is the CAS number of Methylaminoformyl chloride?
The CAS number of Methylaminoformyl chloride is 6452-47-7.
What is the EC number of Methylaminoformyl chloride?
The EC number of Methylaminoformyl chloride is 229-253-7.
What is the DSSTox Substance ID of Methylaminoformyl chloride?
The DSSTox Substance ID of Methylaminoformyl chloride is DTXSID60214787.
What is the XLogP3-AA value of Methylaminoformyl chloride?
The XLogP3-AA value of Methylaminoformyl chloride is 0.6.
Is Methylaminoformyl chloride a canonicalized compound?
Yes, Methylaminoformyl chloride is canonicalized.
Recommended Products
