What is the molecular formula of Methyl tropate?
The molecular formula of Methyl tropate is C10H12O3.
What is the IUPAC name of Methyl tropate?
The IUPAC name of Methyl tropate is methyl 3-hydroxy-2-phenylpropanoate.
What is the CAS number of Methyl tropate?
The CAS number of Methyl tropate is 3967-53-1.
What is the molecular weight of Methyl tropate?
The molecular weight of Methyl tropate is 180.20 g/mol.
What is the InChI of Methyl tropate?
The InChI of Methyl tropate is InChI=1S/C10H12O3/c1-13-10(12)9(7-11)8-5-3-2-4-6-8/h2-6,9,11H,7H2,1H3.
What is the InChIKey of Methyl tropate?
The InChIKey of Methyl tropate is OLEWRQVKIUHEJP-UHFFFAOYSA-N.
What is the XLogP3 value of Methyl tropate?
The XLogP3 value of Methyl tropate is 1.1.
How many hydrogen bond donor counts does Methyl tropate have?
Methyl tropate has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Methyl tropate have?
Methyl tropate has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does Methyl tropate have?
Methyl tropate has 4 rotatable bond counts.