What is the PubChem CID of Methyl N-methylalaninate hydrochloride?
The PubChem CID of Methyl N-methylalaninate hydrochloride is 23437773.
What is the molecular formula of Methyl N-methylalaninate hydrochloride?
The molecular formula of Methyl N-methylalaninate hydrochloride is C5H12ClNO2.
What are the synonyms for Methyl N-methylalaninate hydrochloride?
The synonyms for Methyl N-methylalaninate hydrochloride are 114079-50-4, 2-Methylamino-propionic acid methyl ester hydrochloride, methyl 2-(methylamino)propanoate hydrochloride, and METHYL N-METHYLALANINATE HYDROCHLORIDE.
What is the molecular weight of Methyl N-methylalaninate hydrochloride?
The molecular weight of Methyl N-methylalaninate hydrochloride is 153.61 g/mol.
What is the IUPAC Name of Methyl N-methylalaninate hydrochloride?
The IUPAC Name of Methyl N-methylalaninate hydrochloride is methyl 2-(methylamino)propanoate;hydrochloride.
What is the InChI of Methyl N-methylalaninate hydrochloride?
The InChI of Methyl N-methylalaninate hydrochloride is InChI=1S/C5H11NO2.ClH/c1-4(6-2)5(7)8-3;/h4,6H,1-3H3;1H.
What is the InChIKey of Methyl N-methylalaninate hydrochloride?
The InChIKey of Methyl N-methylalaninate hydrochloride is CYMQHMBRKIJBGI-UHFFFAOYSA-N.
What is the canonical SMILES representation of Methyl N-methylalaninate hydrochloride?
The canonical SMILES representation of Methyl N-methylalaninate hydrochloride is CC(C(=O)OC)NC.Cl.
What is the CAS number of Methyl N-methylalaninate hydrochloride?
The CAS number of Methyl N-methylalaninate hydrochloride is 114079-50-4.
Is Methyl N-methylalaninate hydrochloride a canonicalized compound?
Yes, Methyl N-methylalaninate hydrochloride is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.