The molecular formula of the compound is C17H16O5.
What are the synonyms for the compound?
The synonyms for the compound include 351336-10-2, methyl 4-[(4-formyl-2-methoxyphenoxy)methyl]benzoate, methyl 4-(4-formyl-2-methoxyphenoxymethyl)benzoate, C17H16O5, and 4-(4-Formyl-2-methoxy-phenoxymethyl)-benzoic acid methyl ester.
What is the molecular weight of the compound?
The molecular weight of the compound is 300.30 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is methyl 4-[(4-formyl-2-methoxyphenoxy)methyl]benzoate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C17H16O5/c1-20-16-9-13(10-18)5-8-15(16)22-11-12-3-6-14(7-4-12)17(19)21-2/h3-10H,11H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is SXQFUFPFCNTWEB-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is COC1=C(C=CC(=C1)C=O)OCC2=CC=C(C=C2)C(=O)OC.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.7.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 5 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.