Methyl-(2-phenyl-propyl)-amine

• Catalog Number: ACMA00000829
• Category: Amines
• Molecular Weight: 149.23
• Molecular Formula: C₁₀H₁₅N
• Hazard Statements: H301 + H311 + H331-H315-H319-H335-H412
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of Methyl-(2-phenyl-propyl)-amine?

The molecular formula is C10H15N.

What is the molecular weight of Methyl-(2-phenyl-propyl)-amine?

The molecular weight is 149.23 g/mol.

What is the IUPAC name of Methyl-(2-phenyl-propyl)-amine?

The IUPAC name is N-methyl-2-phenylpropan-1-amine.

What is the InChI of Methyl-(2-phenyl-propyl)-amine?

The InChI is InChI=1S/C10H15N/c1-9(8-11-2)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3.

What is the InChIKey of Methyl-(2-phenyl-propyl)-amine?

The InChIKey is AUFSOOYCQYDGES-UHFFFAOYSA-N.

What is the canonical SMILES of Methyl-(2-phenyl-propyl)-amine?

The canonical SMILES is CC(CNC)C1=CC=CC=C1.

What is the CAS number of Methyl-(2-phenyl-propyl)-amine?

The CAS number is 93-88-9.

What is the synonyms of Methyl-(2-phenyl-propyl)-amine?

The synonyms are PHENPROMETHAMINE, N-methyl-2-phenylpropan-1-amine, Vonedrine.

What is the XLogP3-AA value of Methyl-(2-phenyl-propyl)-amine?

The XLogP3-AA value is 2.1.

What is the topological polar surface area of Methyl-(2-phenyl-propyl)-amine?

The topological polar surface area is 12Ų.