What is the molecular formula of Methyl 2-Bromobutyrate?
The molecular formula of Methyl 2-Bromobutyrate is C5H9BrO2.
What are the synonyms of Methyl 2-Bromobutyrate?
The synonyms of Methyl 2-Bromobutyrate are Methyl 2-bromobutanoate, 2-Bromobutyric Acid Methyl Ester, and Butanoic acid, 2-bromo-, methyl ester.
What is the molecular weight of Methyl 2-Bromobutyrate?
The molecular weight of Methyl 2-Bromobutyrate is 181.03 g/mol.
What is the IUPAC name of Methyl 2-Bromobutyrate?
The IUPAC name of Methyl 2-Bromobutyrate is methyl 2-bromobutanoate.
What is the InChI of Methyl 2-Bromobutyrate?
The InChI of Methyl 2-Bromobutyrate is InChI=1S/C5H9BrO2/c1-3-4(6)5(7)8-2/h4H,3H2,1-2H3.
What is the InChIKey of Methyl 2-Bromobutyrate?
The InChIKey of Methyl 2-Bromobutyrate is UFQQDNMQADCHGH-UHFFFAOYSA-N.
What is the Canonical SMILES of Methyl 2-Bromobutyrate?
The Canonical SMILES of Methyl 2-Bromobutyrate is CCC(C(=O)OC)Br.
What is the CAS number of Methyl 2-Bromobutyrate?
The CAS number of Methyl 2-Bromobutyrate is 3196-15-4.
What is the XLogP3-AA value of Methyl 2-Bromobutyrate?
The XLogP3-AA value of Methyl 2-Bromobutyrate is 1.8.
Is Methyl 2-Bromobutyrate a canonicalized compound?
Yes, Methyl 2-Bromobutyrate is a canonicalized compound according to PubChem.