Methyl 2-(4-isobutylphenyl)propanoate

• Catalog Number: ACMA00002400
• Category: Ethers
• Molecular Weight: 220.31
• Molecular Formula: C₁₄H₁₉NO₄
• Hazard Statements: H302-H317
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of Methyl 2-(4-isobutylphenyl)propanoate?

The molecular formula is C14H20O2.

What is the molecular weight of Methyl 2-(4-isobutylphenyl)propanoate?

The molecular weight is 220.31 g/mol.

What is the IUPAC name of Methyl 2-(4-isobutylphenyl)propanoate?

The IUPAC name is methyl 2-[4-(2-methylpropyl)phenyl]propanoate.

What is the InChI of Methyl 2-(4-isobutylphenyl)propanoate?

The InChI is InChI=1S/C14H20O2/c1-10(2)9-12-5-7-13(8-6-12)11(3)14(15)16-4/h5-8,10-11H,9H2,1-4H3.

What is the InChIKey of Methyl 2-(4-isobutylphenyl)propanoate?

The InChIKey is YNZYUHPFNYBBFF-UHFFFAOYSA-N.

What is the canonical SMILES of Methyl 2-(4-isobutylphenyl)propanoate?

The canonical SMILES is CC(C)CC1=CC=C(C=C1)C(C)C(=O)OC.

What is the CAS number of Methyl 2-(4-isobutylphenyl)propanoate?

The CAS number is 61566-34-5.

What is the XLogP3 value of Methyl 2-(4-isobutylphenyl)propanoate?

The XLogP3 value is 3.8.

What is the hydrogen bond donor count of Methyl 2-(4-isobutylphenyl)propanoate?

The hydrogen bond donor count is 0.

What is the hydrogen bond acceptor count of Methyl 2-(4-isobutylphenyl)propanoate?

The hydrogen bond acceptor count is 2.