What is the molecular formula of Meprednisone?
The molecular formula of Meprednisone is C22H28O5.
What is the molecular weight of Meprednisone?
The molecular weight of Meprednisone is 372.5 g/mol.
What is the IUPAC name of Meprednisone?
The IUPAC name of Meprednisone is (8S,9S,10R,13S,14S,16S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione.
What is the InChIKey of Meprednisone?
The InChIKey of Meprednisone is PIDANAQULIKBQS-RNUIGHNZSA-N.
What is the canonical SMILES of Meprednisone?
The canonical SMILES of Meprednisone is CC1CC2C3CCC4=CC(=O)C=CC4(C3C(=O)CC2(C1(C(=O)CO)O)C)C.
What is the CAS number of Meprednisone?
The CAS number of Meprednisone is 1247-42-3.
What is the UNII of Meprednisone?
The UNII of Meprednisone is 67U96J8P35.
What is the XLogP3 value of Meprednisone?
The XLogP3 value of Meprednisone is 1.9.
How many hydrogen bond donor counts does Meprednisone have?
Meprednisone has 2 hydrogen bond donor counts.
How many rotatable bond counts does Meprednisone have?
Meprednisone has 2 rotatable bond counts.