What is the molecular formula of melengestrol?
The molecular formula of melengestrol is C23H30O3.
What is the molecular weight of melengestrol?
The molecular weight of melengestrol is 354.5 g/mol.
What is the IUPAC name of melengestrol?
The IUPAC name of melengestrol is (8R,9S,10R,13S,14S,17R)-17-acetyl-17-hydroxy-6,10,13-trimethyl-16-methylidene-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one.
What is the InChIKey of melengestrol?
The InChIKey of melengestrol is OKHAOBQKCCIRLO-IBVJIVQJSA-N.
What is the Canonical SMILES of melengestrol?
The Canonical SMILES of melengestrol is CC1=CC2C(CCC3(C2CC(=C)C3(C(=O)C)O)C)C4(C1=CC(=O)CC4)C.
What is the CAS number of melengestrol?
The CAS number of melengestrol is 5633-18-1.
What is the UNII of melengestrol?
The UNII of melengestrol is BX98J4T6JU.
What is the NCI Thesaurus Code of melengestrol?
The NCI Thesaurus Code of melengestrol is C1659.
What is the XLogP3-AA value of melengestrol?
The XLogP3-AA value of melengestrol is 2.5.
What is the topological polar surface area of melengestrol?
The topological polar surface area of melengestrol is 54.4Ų.