What is the molecular formula of zinc maleate?
The molecular formula of zinc maleate is C4H4O4Zn.
What is the molecular weight of zinc maleate?
The molecular weight of zinc maleate is 181.5 g/mol.
What is the PubChem CID for zinc maleate?
The PubChem CID for zinc maleate is 59038281.
What is the IUPAC name of zinc maleate?
The IUPAC name of zinc maleate is (Z)-but-2-enedioic acid;zinc.
What is the InChI for zinc maleate?
The InChI for zinc maleate is InChI=1S/C4H4O4.Zn/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/b2-1-.
What is the InChIKey for zinc maleate?
The InChIKey for zinc maleate is PKMTWMDBJHRDBM-ODZAUARKSA-N.
How many hydrogen bond donor counts does zinc maleate have?
Zinc maleate has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does zinc maleate have?
Zinc maleate has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does zinc maleate have?
Zinc maleate has 0 rotatable bond counts.
What is the topological polar surface area of zinc maleate?
The topological polar surface area of zinc maleate is 74.6Ų.