What is the molecular formula of Macamide impurity 10?
The molecular formula of Macamide impurity 10 is C26H41NO2.
What are the synonyms for Macamide impurity 10?
The synonyms for Macamide impurity 10 are 883715-22-8, N-(3-METHOXYBENZYL-(9Z,12Z)-OCTADECADIENAMIDE, N-(3-Methoxy)Benzyllinoleamide, and (9Z,12Z)-N-(3-Methoxybenzyl)octadeca-9,12-dienamide.
When was Macamide impurity 10 created?
Macamide impurity 10 was created on April 3, 2014.
What is the molecular weight of Macamide impurity 10?
The molecular weight of Macamide impurity 10 is 399.6 g/mol.
What is the IUPAC name of Macamide impurity 10?
The IUPAC name of Macamide impurity 10 is (9Z,12Z)-N-[(3-methoxyphenyl)methyl]octadeca-9,12-dienamide.
What is the InChI of Macamide impurity 10?
The InChI of Macamide impurity 10 is InChI=1S/C26H41NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-26(28)27-23-24-19-18-20-25(22-24)29-2/h7-8,10-11,18-20,22H,3-6,9,12-17,21,23H2,1-2H3,(H,27,28)/b8-7-,11-10-.
What is the InChIKey of Macamide impurity 10?
The InChIKey of Macamide impurity 10 is BMQBTHWVNBJSPS-NQLNTKRDSA-N.
What is the Canonical SMILES of Macamide impurity 10?
The Canonical SMILES of Macamide impurity 10 is CCCCCC=CCC=CCCCCCCCC(=O)NCC1=CC(=CC=C1)OC.
What is the CAS number of Macamide impurity 10?
The CAS number of Macamide impurity 10 is 883715-22-8.
What is the XLogP3-AA value of Macamide impurity 10?
The XLogP3-AA value of Macamide impurity 10 is 7.8.