What is the molecular formula of m-Tolyl-acetyl chloride?
The molecular formula of m-Tolyl-acetyl chloride is C9H9ClO.
What is the molecular weight of m-Tolyl-acetyl chloride?
The molecular weight of m-Tolyl-acetyl chloride is 168.62 g/mol.
What is the IUPAC name of m-Tolyl-acetyl chloride?
The IUPAC name of m-Tolyl-acetyl chloride is 2-(3-methylphenyl)acetyl chloride.
What is the InChI of m-Tolyl-acetyl chloride?
The InChI of m-Tolyl-acetyl chloride is InChI=1S/C9H9ClO/c1-7-3-2-4-8(5-7)6-9(10)11/h2-5H,6H2,1H3.
What is the InChIKey of m-Tolyl-acetyl chloride?
The InChIKey of m-Tolyl-acetyl chloride is BGGKEDDFKBVTDK-UHFFFAOYSA-N.
What is the canonical SMILES of m-Tolyl-acetyl chloride?
The canonical SMILES of m-Tolyl-acetyl chloride is CC1=CC(=CC=C1)CC(=O)Cl.
What is the CAS number of m-Tolyl-acetyl chloride?
The CAS number of m-Tolyl-acetyl chloride is 13910-79-7.
What is the European Community (EC) number of m-Tolyl-acetyl chloride?
The European Community (EC) number of m-Tolyl-acetyl chloride is 673-226-6.
Is m-Tolyl-acetyl chloride a canonicalized compound?
Yes, m-Tolyl-acetyl chloride is a canonicalized compound.