What is the molecular formula of m,m-Dicarboxybiphenyl?
The molecular formula of m,m-Dicarboxybiphenyl is C14H10O4.
What is the molecular weight of m,m-Dicarboxybiphenyl?
The molecular weight of m,m-Dicarboxybiphenyl is 242.23 g/mol.
When was m,m-Dicarboxybiphenyl created?
m,m-Dicarboxybiphenyl was created on March 26, 2005.
When was m,m-Dicarboxybiphenyl last modified?
m,m-Dicarboxybiphenyl was last modified on December 30, 2023.
What is the IUPAC name of m,m-Dicarboxybiphenyl?
The IUPAC name of m,m-Dicarboxybiphenyl is 3-(3-carboxyphenyl)benzoic acid.
What is the InChI of m,m-Dicarboxybiphenyl?
The InChI of m,m-Dicarboxybiphenyl is InChI=1S/C14H10O4/c15-13(16)11-5-1-3-9(7-11)10-4-2-6-12(8-10)14(17)18/h1-8H,(H,15,16)(H,17,18).
What is the InChIKey of m,m-Dicarboxybiphenyl?
The InChIKey of m,m-Dicarboxybiphenyl is KHZYMPDILLAIQY-UHFFFAOYSA-N.
What is the canonical SMILES of m,m-Dicarboxybiphenyl?
The canonical SMILES of m,m-Dicarboxybiphenyl is C1=CC(=CC(=C1)C(=O)O)C2=CC(=CC=C2)C(=O)O.
What is the CAS number of m,m-Dicarboxybiphenyl?
The CAS number of m,m-Dicarboxybiphenyl is 612-87-3.