What is the molecular formula of Tomelukast?
The molecular formula of Tomelukast is C16H22N4O3.
What is the molecular weight of Tomelukast?
The molecular weight of Tomelukast is 318.37 g/mol.
What is the IUPAC name of Tomelukast?
The IUPAC name of Tomelukast is 1-[2-hydroxy-3-propyl-4-[4-(2H-tetrazol-5-yl)butoxy]phenyl]ethanone.
What is the InChIKey of Tomelukast?
The InChIKey of Tomelukast is MWYHLEQJTQJHSS-UHFFFAOYSA-N.
What is the Canonical SMILES of Tomelukast?
The Canonical SMILES of Tomelukast is CCCC1=C(C=CC(=C1O)C(=O)C)OCCCCC2=NNN=N2.
How many hydrogen bond donor counts does Tomelukast have?
Tomelukast has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Tomelukast have?
Tomelukast has 6 hydrogen bond acceptor counts.
What is the topological polar surface area of Tomelukast?
The topological polar surface area of Tomelukast is 101 Å^2.
How many rotatable bond counts does Tomelukast have?
Tomelukast has 9 rotatable bond counts.
What is the complexity value of Tomelukast?
The complexity value of Tomelukast is 369.