What is the molecular formula of Labetalol impurity A?
The molecular formula of Labetalol impurity A is C19H23NO4.
What is the molecular weight of Labetalol impurity A?
The molecular weight of Labetalol impurity A is 329.4 g/mol.
When was Labetalol impurity A created?
Labetalol impurity A was created on November 1, 2013.
When was Labetalol impurity A last modified?
Labetalol impurity A was last modified on December 30, 2023.
What is the IUPAC name of Labetalol impurity A?
The IUPAC name of Labetalol impurity A is 2-hydroxy-5-[1-hydroxy-2-(4-phenylbutan-2-ylamino)ethyl]benzoic acid.
What is the InChI of Labetalol impurity A?
The InChI of Labetalol impurity A is InChI=1S/C19H23NO4/c1-13(7-8-14-5-3-2-4-6-14)20-12-18(22)15-9-10-17(21)16(11-15)19(23)24/h2-6,9-11,13,18,20-22H,7-8,12H2,1H3,(H,23,24).
What is the InChIKey of Labetalol impurity A?
The InChIKey of Labetalol impurity A is DZBUYRWVQLOXQQ-UHFFFAOYSA-N.
What is the canonical SMILES of Labetalol impurity A?
The canonical SMILES of Labetalol impurity A is CC(CCC1=CC=CC=C1)NCC(C2=CC(=C(C=C2)O)C(=O)O).
What is the CAS number of Labetalol impurity A?
The CAS number of Labetalol impurity A is 1391051-99-2.
Is Labetalol impurity A a canonicalized compound?
Yes, Labetalol impurity A is a canonicalized compound.