What is the molecular formula of L-2-aminoadipic acid?
The molecular formula of L-2-aminoadipic acid is C6H11NO4.
What is the molecular weight of L-2-aminoadipic acid?
The molecular weight of L-2-aminoadipic acid is 161.16 g/mol.
What is the IUPAC name of L-2-aminoadipic acid?
The IUPAC name of L-2-aminoadipic acid is (2S)-2-aminohexanedioic acid.
What is the InChI of L-2-aminoadipic acid?
The InChI of L-2-aminoadipic acid is InChI=1S/C6H11NO4/c7-4(6(10)11)2-1-3-5(8)9/h4H,1-3,7H2,(H,8,9)(H,10,11)/t4-/m0/s1.
What is the InChIKey of L-2-aminoadipic acid?
The InChIKey of L-2-aminoadipic acid is OYIFNHCXNCRBQI-BYPYZUCNSA-N.
What is the canonical SMILES of L-2-aminoadipic acid?
The canonical SMILES of L-2-aminoadipic acid is C(CC(C(=O)O)N)CC(=O)O.
What is the CAS number of L-2-aminoadipic acid?
The CAS number of L-2-aminoadipic acid is 1118-90-7.
How many hydrogen bond donor counts does L-2-aminoadipic acid have?
L-2-aminoadipic acid has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does L-2-aminoadipic acid have?
L-2-aminoadipic acid has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does L-2-aminoadipic acid have?
L-2-aminoadipic acid has 5 rotatable bond counts.