What is the molecular formula of Isonox(R)232?
The molecular formula of Isonox(R)232 is C23H40O.
What is the molecular weight of Isonox(R)232?
The molecular weight of Isonox(R)232 is 332.6 g/mol.
What is the IUPAC name of Isonox(R)232?
The IUPAC name of Isonox(R)232 is 2,6-ditert-butyl-4-nonylphenol.
What is the InChI of Isonox(R)232?
The InChI of Isonox(R)232 is InChI=1S/C23H40O/c1-8-9-10-11-12-13-14-15-18-16-19(22(2,3)4)21(24)20(17-18)23(5,6)7/h16-17,24H,8-15H2,1-7H3.
What is the InChIKey of Isonox(R)232?
The InChIKey of Isonox(R)232 is VQQLTEBUMLSLFJ-UHFFFAOYSA-N.
What is the canonical SMILES of Isonox(R)232?
The canonical SMILES of Isonox(R)232 is CCCCCCCCCC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C.
What is the CAS number of Isonox(R)232?
The CAS number of Isonox(R)232 is 4306-88-1.
What is the European Community (EC) number of Isonox(R)232?
The European Community (EC) number of Isonox(R)232 is 224-320-7.
What is the DSSTox Substance ID of Isonox(R)232?
The DSSTox Substance ID of Isonox(R)232 is DTXSID4063404.
Is Isonox(R)232 a canonicalized compound?
Yes, Isonox(R)232 is a canonicalized compound.