What is the PubChem CID of isobutylgermane?
The PubChem CID of isobutylgermane is 57473004.
What is the molecular formula of isobutylgermane?
The molecular formula of isobutylgermane is C4H9Ge.
What is the molecular weight of isobutylgermane?
The molecular weight of isobutylgermane is 129.74 g/mol.
What is the InChI of isobutylgermane?
The InChI of isobutylgermane is InChI=1S/C4H9Ge/c1-4(2)3-5/h4H,3H2,1-2H3.
What is the InChIKey of isobutylgermane?
The InChIKey of isobutylgermane is XCLKKWIIZMHQIV-UHFFFAOYSA-N.
What is the CAS number of isobutylgermane?
The CAS number of isobutylgermane is 768403-89-0.
What is the European Community (EC) number of isobutylgermane?
The European Community (EC) number of isobutylgermane is 682-844-5.
What is the hydrogen bond donor count of isobutylgermane?
The hydrogen bond donor count of isobutylgermane is 0.
What is the hydrogen bond acceptor count of isobutylgermane?
The hydrogen bond acceptor count of isobutylgermane is 0.
Is isobutylgermane a canonicalized compound?
Yes, isobutylgermane is a canonicalized compound according to PubChem.