What is the molecular formula of isobutaneboronic acid?
The molecular formula of isobutaneboronic acid is C4H11BO2.
What are the synonyms for isobutaneboronic acid?
The synonyms for isobutaneboronic acid are Isobutylboronic Acid, 84110-40-7, Isobutaneboronic acid, 2-Methylpropylboronic acid, and (2-Methylpropyl)boronic acid.
What is the molecular weight of isobutaneboronic acid?
The molecular weight of isobutaneboronic acid is 101.94 g/mol.
What is the IUPAC name of isobutaneboronic acid?
The IUPAC name of isobutaneboronic acid is 2-methylpropylboronic acid.
What is the InChI of isobutaneboronic acid?
The InChI of isobutaneboronic acid is InChI=1S/C4H11BO2/c1-4(2)3-5(6)7/h4,6-7H,3H2,1-2H3.
What is the InChIKey of isobutaneboronic acid?
The InChIKey of isobutaneboronic acid is ZAZPDOYUCVFPOI-UHFFFAOYSA-N.
What is the canonical SMILES of isobutaneboronic acid?
The canonical SMILES of isobutaneboronic acid is B(CC(C)C)(O)O.
What is the CAS number of isobutaneboronic acid?
The CAS number of isobutaneboronic acid is 84110-40-7.
How many hydrogen bond donor counts does isobutaneboronic acid have?
Isobutaneboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does isobutaneboronic acid have?
Isobutaneboronic acid has 2 hydrogen bond acceptor counts.