What is the molecular formula of Irgastab fs 042?
The molecular formula of Irgastab fs 042 is C36H75NO.
What is the molecular weight of Irgastab fs 042?
The molecular weight of Irgastab fs 042 is 538.0 g/mol.
What is the IUPAC name of Irgastab fs 042?
The IUPAC name of Irgastab fs 042 is N,N-dioctadecylhydroxylamine.
What is the InChI of Irgastab fs 042?
The InChI of Irgastab fs 042 is InChI=1S/C36H75NO/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37(38)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h38H,3-36H2,1-2H3.
What is the InChIKey of Irgastab fs 042?
The InChIKey of Irgastab fs 042 is ITUWQZXQRZLLCR-UHFFFAOYSA-N.
What is the canonical SMILES of Irgastab fs 042?
The canonical SMILES of Irgastab fs 042 is CCCCCCCCCCCCCCCCCCN(CCCCCCCCCCCCCCCCCC)O.
What are some synonyms of Irgastab fs 042?
Some synonyms of Irgastab fs 042 include N,N-dioctadecylhydroxylamine, 143925-92-2, Bis(octadecyl)hydroxylamine, IRGASTAB FS 042, distearyl hydroxylamine, and more.
What is the CAS number of Irgastab fs 042?
The CAS number of Irgastab fs 042 is 143925-92-2.
What is the European Community (EC) number of Irgastab fs 042?
The European Community (EC) number of Irgastab fs 042 is 604-386-7.
Is Irgastab fs 042 a canonicalized compound?
Yes, Irgastab fs 042 is a canonicalized compound according to PubChem.