What is the PubChem CID for Indole-6-boronic acid?
PubChem CID 2763205
What is the molecular formula for Indole-6-boronic acid?
The molecular formula is C8H8BNO2.
What is the molecular weight of Indole-6-boronic acid?
The molecular weight is 160.97 g/mol.
What is the IUPAC name of Indole-6-boronic acid?
The IUPAC name is 1H-indol-6-ylboronic acid.
What is the InChI of Indole-6-boronic acid?
The InChI is InChI=1S/C8H8BNO2/c11-9(12)7-2-1-6-3-4-10-8(6)5-7/h1-5,10-12H.
What is the InChIKey of Indole-6-boronic acid?
The InChIKey is ZVMHOIWRCCZGPZ-UHFFFAOYSA-N.
What is the canonical SMILES of Indole-6-boronic acid?
The canonical SMILES is B(C1=CC2=C(C=C1)C=CN2)(O)O.
What is the CAS number of Indole-6-boronic acid?
The CAS number is 147621-18-9.
What is the European Community (EC) number of Indole-6-boronic acid?
The EC number is 627-185-6.
Is Indole-6-boronic acid a canonicalized compound?
Yes, Indole-6-boronic acid is a canonicalized compound.