What is the molecular formula of Indole-4-carboxylic acid?
The molecular formula is C9H7NO2.
What is the molecular weight of Indole-4-carboxylic acid?
The molecular weight is 161.16 g/mol.
What is the IUPAC name of Indole-4-carboxylic acid?
The IUPAC name is 1H-indole-4-carboxylic acid.
What is the InChI code of Indole-4-carboxylic acid?
The InChI code is InChI=1S/C9H7NO2/c11-9(12)7-2-1-3-8-6(7)4-5-10-8/h1-5,10H,(H,11,12)
What is the InChIKey of Indole-4-carboxylic acid?
The InChIKey is ROGHUJUFCRFUSO-UHFFFAOYSA-N.
What is the canonical SMILES of Indole-4-carboxylic acid?
The canonical SMILES is C1=CC(=C2C=CNC2=C1)C(=O)O.
What is the CAS number of Indole-4-carboxylic acid?
The CAS number is 2124-55-2.
What is the European Community (EC) number of Indole-4-carboxylic acid?
The European Community (EC) number is 621-279-0.
What is the ChEMBL ID of Indole-4-carboxylic acid?
The ChEMBL ID is CHEMBL2018157.
Is Indole-4-carboxylic acid a canonicalized compound?
Yes, Indole-4-carboxylic acid is a canonicalized compound according to PubChem.