What is the molecular formula of Indole-4-boronic acid?
The molecular formula of Indole-4-boronic acid is C8H8BNO2.
What is the molecular weight of Indole-4-boronic acid?
The molecular weight of Indole-4-boronic acid is 160.97 g/mol.
What is the IUPAC name of Indole-4-boronic acid?
The IUPAC name of Indole-4-boronic acid is 1H-indol-4-ylboronic acid.
What is the InChI of Indole-4-boronic acid?
The InChI of Indole-4-boronic acid is InChI=1S/C8H8BNO2/c11-9(12)7-2-1-3-8-6(7)4-5-10-8/h1-5,10-12H.
What is the InChIKey of Indole-4-boronic acid?
The InChIKey of Indole-4-boronic acid is USJUQEVUEBCLLR-UHFFFAOYSA-N.
What is the canonical SMILES of Indole-4-boronic acid?
The canonical SMILES of Indole-4-boronic acid is B(C1=C2C=CNC2=CC=C1)(O)O.
What is the CAS number of Indole-4-boronic acid?
The CAS number of Indole-4-boronic acid is 220465-43-0.
What is the EC number of Indole-4-boronic acid?
The EC number of Indole-4-boronic acid is 640-120-6.
What is the DSSTox Substance ID of Indole-4-boronic acid?
The DSSTox Substance ID of Indole-4-boronic acid is DTXSID90376786.
Is Indole-4-boronic acid a canonicalized compound?
Yes, Indole-4-boronic acid is a canonicalized compound.