What is the PubChem CID for Imexon?
The PubChem CID for Imexon is 68791.
What is the molecular formula of Imexon?
The molecular formula of Imexon is C4H5N3O.
What are some synonyms for Imexon?
Some synonyms for Imexon include BM-06002, 4-Amino-1,3-diazabicyclo[3.1.0]hex-3-en-2-one, MLS002702958, 4-Imino-1,3-diazabicyclo[3.1.0]hexan-2-one, NSC313425, and Amplimexon.
What is the molecular weight of Imexon?
The molecular weight of Imexon is 111.10 g/mol.
When was Imexon created?
Imexon was created on March 26, 2005.
When was Imexon last modified?
Imexon was last modified on December 30, 2023.
What is the IUPAC name of Imexon?
The IUPAC name of Imexon is 4-amino-1,3-diazabicyclo[3.1.0]hex-3-en-2-one.
What is the InChI of Imexon?
The InChI of Imexon is InChI=1S/C4H5N3O/c5-3-2-1-7(2)4(8)6-3/h2H,1H2,(H2,5,6,8).
What is the InChIKey of Imexon?
The InChIKey of Imexon is BIXBBIPTYBJTRY-UHFFFAOYSA-N.
How many hydrogen bond donor counts does Imexon have?
Imexon has one hydrogen bond donor count.