What is the molecular formula of Hydroxyguanidine sulfate?
The molecular formula of Hydroxyguanidine sulfate is CH7N3O5S.
What are the synonyms for Hydroxyguanidine sulfate?
The synonyms for Hydroxyguanidine sulfate are 1-Hydroxyguanidine sulfate, 2-hydroxyguanidine;sulfuric acid, 129656-40-2, and 1-Hydroxyguanidinesulfate.
What is the molecular weight of Hydroxyguanidine sulfate?
The molecular weight of Hydroxyguanidine sulfate is 173.15 g/mol.
What is the IUPAC name of Hydroxyguanidine sulfate?
The IUPAC name of Hydroxyguanidine sulfate is 2-hydroxyguanidine;sulfuric acid.
What is the InChI of Hydroxyguanidine sulfate?
The InChI of Hydroxyguanidine sulfate is InChI=1S/CH5N3O.H2O4S/c2-1(3)4-5;1-5(2,3)4/h5H,(H4,2,3,4);(H2,1,2,3,4).
What is the CAS number of Hydroxyguanidine sulfate?
The CAS number of Hydroxyguanidine sulfate is 6345-29-5.
How many hydrogen bond donor counts does Hydroxyguanidine sulfate have?
Hydroxyguanidine sulfate has 5 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Hydroxyguanidine sulfate have?
Hydroxyguanidine sulfate has 6 hydrogen bond acceptor counts.
What is the topological polar surface area of Hydroxyguanidine sulfate?
The topological polar surface area of Hydroxyguanidine sulfate is 168Ų.
How many covalently-bonded unit counts does Hydroxyguanidine sulfate have?
Hydroxyguanidine sulfate has 2 covalently-bonded unit counts.