What is the molecular formula of Hexadecahydropyrene?
The molecular formula of Hexadecahydropyrene is C16H26.
What is the molecular weight of Hexadecahydropyrene?
The molecular weight of Hexadecahydropyrene is 218.38 g/mol.
What is the IUPAC name of Hexadecahydropyrene?
The IUPAC name of Hexadecahydropyrene is 1,2,3,3a,4,5,5a,6,7,8,8a,9,10,10a,10b,10c-hexadecahydropyrene.
What is the InChI of Hexadecahydropyrene?
The InChI of Hexadecahydropyrene is InChI=1S/C16H26/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h11-16H,1-10H2.
What is the InChIKey of Hexadecahydropyrene?
The InChIKey of Hexadecahydropyrene is BYBPEZLZCGOWIS-UHFFFAOYSA-N.
What is the canonical SMILES of Hexadecahydropyrene?
The canonical SMILES of Hexadecahydropyrene is C1CC2CCC3CCCC4C3C2C(C1)CC4.
What is the CAS number of Hexadecahydropyrene?
The CAS number of Hexadecahydropyrene is 2435-85-0.
How many hydrogen bond donor counts does Hexadecahydropyrene have?
Hexadecahydropyrene has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Hexadecahydropyrene have?
Hexadecahydropyrene has 0 hydrogen bond acceptor counts.
How many rotatable bond counts does Hexadecahydropyrene have?
Hexadecahydropyrene has 0 rotatable bond counts.