What is the molecular formula of H-Tyr-obzl?
The molecular formula of H-Tyr-obzl is C16H17NO3.
What is the molecular weight of H-Tyr-obzl?
The molecular weight of H-Tyr-obzl is 271.31 g/mol.
What is the IUPAC name of H-Tyr-obzl?
The IUPAC name of H-Tyr-obzl is benzyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate.
What is the InChI of H-Tyr-obzl?
The InChI of H-Tyr-obzl is InChI=1S/C16H17NO3/c17-15(10-12-6-8-14(18)9-7-12)16(19)20-11-13-4-2-1-3-5-13/h1-9,15,18H,10-11,17H2/t15-/m0/s1.
What is the InChIKey of H-Tyr-obzl?
The InChIKey of H-Tyr-obzl is BVCTWRNVKLXEQC-HNNXBMFYSA-N.
What is the canonical SMILES of H-Tyr-obzl?
The canonical SMILES of H-Tyr-obzl is C1=CC=C(C=C1)COC(=O)C(CC2=CC=C(C=C2)O)N.
What is the molecular weight of H-Tyr-obzl according to PubChem?
The molecular weight of H-Tyr-obzl according to PubChem is 271.31 g/mol.
What is the XLogP3 value of H-Tyr-obzl?
The XLogP3 value of H-Tyr-obzl is 1.9.
How many hydrogen bond donor counts does H-Tyr-obzl have?
H-Tyr-obzl has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does H-Tyr-obzl have?
H-Tyr-obzl has 4 hydrogen bond acceptor counts.