What is the molecular formula of H-Phe-leu-obzl?
The molecular formula of H-Phe-leu-obzl is C22H28N2O3.
What are the synonyms for H-Phe-leu-obzl?
The synonyms for H-Phe-leu-obzl are 63649-15-0, L-phenylalanyl-L-leucine benzyl ester, benzyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate, and Phe-Leu-OBzl.
When was H-Phe-leu-obzl created and last modified?
H-Phe-leu-obzl was created on October 26, 2006, and was last modified on November 25, 2023.
What is the IUPAC name of H-Phe-leu-obzl?
The IUPAC name of H-Phe-leu-obzl is benzyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate.
What is the InChI of H-Phe-leu-obzl?
The InChI of H-Phe-leu-obzl is InChI=1S/C22H28N2O3/c1-16(2)13-20(22(26)27-15-18-11-7-4-8-12-18)24-21(25)19(23)14-17-9-5-3-6-10-17/h3-12,16,19-20H,13-15,23H2,1-2H3,(H,24,25)/t19-,20-/m0/s1.
What is the InChIKey of H-Phe-leu-obzl?
The InChIKey of H-Phe-leu-obzl is WHGLYHPTKLTQMK-PMACEKPBSA-N.
What is the canonical SMILES of H-Phe-leu-obzl?
The canonical SMILES of H-Phe-leu-obzl is CC(C)CC(C(=O)OCC1=CC=CC=C1)NC(=O)C(CC2=CC=CC=C2)N.
What is the molecular weight of H-Phe-leu-obzl?
The molecular weight of H-Phe-leu-obzl is 368.5 g/mol.
What is the XLogP3 value of H-Phe-leu-obzl?
The XLogP3 value of H-Phe-leu-obzl is 2.9.
What is the hydrogen bond donor count of H-Phe-leu-obzl?
The hydrogen bond donor count of H-Phe-leu-obzl is 2.