What is the molecular formula of H-Leu-Leu-OH?
The molecular formula of H-Leu-Leu-OH is C12H24N2O3.
What is the molecular weight of H-Leu-Leu-OH?
The molecular weight of H-Leu-Leu-OH is 244.33 g/mol.
What is the IUPAC name of H-Leu-Leu-OH?
The IUPAC name of H-Leu-Leu-OH is (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoic acid.
What is the InChI of H-Leu-Leu-OH?
The InChI of H-Leu-Leu-OH is InChI=1S/C12H24N2O3/c1-7(2)5-9(13)11(15)14-10(12(16)17)6-8(3)4/h7-10H,5-6,13H2,1-4H3,(H,14,15)(H,16,17)/t9-,10-/m0/s1.
What is the InChIKey of H-Leu-Leu-OH?
The InChIKey of H-Leu-Leu-OH is LCPYQJIKPJDLLB-UWVGGRQHSA-N.
What is the canonical SMILES of H-Leu-Leu-OH?
The canonical SMILES of H-Leu-Leu-OH is CC(C)CC(C(=O)NC(CC(C)C)C(=O)O)N.
What is the CAS number of H-Leu-Leu-OH?
The CAS number of H-Leu-Leu-OH is 3303-31-9.
How many hydrogen bond donor atoms are present in H-Leu-Leu-OH?
H-Leu-Leu-OH has 3 hydrogen bond donor atoms.
How many hydrogen bond acceptor atoms are present in H-Leu-Leu-OH?
H-Leu-Leu-OH has 4 hydrogen bond acceptor atoms.