What is the molecular formula of H-D-Tyr-otbu?
The molecular formula of H-D-Tyr-otbu is C13H19NO3.
What is the molecular weight of H-D-Tyr-otbu?
The molecular weight of H-D-Tyr-otbu is 237.29 g/mol.
What is the IUPAC name of H-D-Tyr-otbu?
The IUPAC name of H-D-Tyr-otbu is tert-butyl (2R)-2-amino-3-(4-hydroxyphenyl)propanoate.
What is the InChI of H-D-Tyr-otbu?
The InChI of H-D-Tyr-otbu is InChI=1S/C13H19NO3/c1-13(2,3)17-12(16)11(14)8-9-4-6-10(15)7-5-9/h4-7,11,15H,8,14H2,1-3H3/t11-/m1/s1.
What is the InChIKey of H-D-Tyr-otbu?
The InChIKey of H-D-Tyr-otbu is DIGHFXIWRPMGSA-LLVKDONJSA-N.
What is the canonical SMILES of H-D-Tyr-otbu?
The canonical SMILES of H-D-Tyr-otbu is CC(C)(C)OC(=O)C(CC1=CC=C(C=C1)O)N.
What is the isomeric SMILES of H-D-Tyr-otbu?
The isomeric SMILES of H-D-Tyr-otbu is CC(C)(C)OC(=O)[C@@H](CC1=CC=C(C=C1)O)N.
How many hydrogen bond donor counts does H-D-Tyr-otbu have?
H-D-Tyr-otbu has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does H-D-Tyr-otbu have?
H-D-Tyr-otbu has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does H-D-Tyr-otbu have?
H-D-Tyr-otbu has 5 rotatable bond counts.