What is the molecular formula of H-Abu-Gly-OH?
The molecular formula of H-Abu-Gly-OH is C6H12N2O3.
What are the synonyms for H-Abu-Gly-OH?
The synonyms for H-Abu-Gly-OH are: 16305-80-9, 2-[[(2S)-2-aminobutanoyl]amino]acetic Acid, and 2-[(2S)-2-aminobutanamido]acetic acid.
What is the molecular weight of H-Abu-Gly-OH?
The molecular weight of H-Abu-Gly-OH is 160.17 g/mol.
What is the IUPAC name of H-Abu-Gly-OH?
The IUPAC name of H-Abu-Gly-OH is 2-[[(2S)-2-aminobutanoyl]amino]acetic acid.
What is the InChI of H-Abu-Gly-OH?
The InChI of H-Abu-Gly-OH is InChI=1S/C6H12N2O3/c1-2-4(7)6(11)8-3-5(9)10/h4H,2-3,7H2,1H3,(H,8,11)(H,9,10)/t4-/m0/s1.
What is the InChIKey of H-Abu-Gly-OH?
The InChIKey of H-Abu-Gly-OH is SVHUWZOIWWJJJM-BYPYZUCNSA-N.
What is the canonical SMILES of H-Abu-Gly-OH?
The canonical SMILES of H-Abu-Gly-OH is CCC(C(=O)NCC(=O)O)N.
How many hydrogen bond donor counts does H-Abu-Gly-OH have?
H-Abu-Gly-OH has 3 hydrogen bond donor counts.
How many rotatable bond counts does H-Abu-Gly-OH have?
H-Abu-Gly-OH has 4 rotatable bond counts.
What is the topological polar surface area of H-Abu-Gly-OH?
The topological polar surface area of H-Abu-Gly-OH is 92.4 Ų.