What is the chemical formula for guanethidine sulfate?
The chemical formula for guanethidine sulfate is C10H24N4O4S.
What are the synonyms for guanethidine sulfate?
The synonyms for guanethidine sulfate are Guanethidine monosulfate, 645-43-2, and Ismelin sulfate.
What is the molecular weight of guanethidine sulfate?
The molecular weight of guanethidine sulfate is 296.39 g/mol.
When was guanethidine sulfate created?
Guanethidine sulfate was created on June 24, 2005.
What is the IUPAC name of guanethidine sulfate?
The IUPAC name of guanethidine sulfate is 2-[2-(azocan-1-yl)ethyl]guanidine; sulfuric acid.
What is the InChIKey of guanethidine sulfate?
The InChIKey of guanethidine sulfate is YUFWAVFNITUSHI-UHFFFAOYSA-N.
What is the canonical SMILES of guanethidine sulfate?
The canonical SMILES of guanethidine sulfate is C1CCCN(CCC1)CCN=C(N)N.OS(=O)(=O)O.
What is the CAS number of guanethidine sulfate?
The CAS number of guanethidine sulfate is 60-02-6.
What is the UNII of guanethidine sulfate?
The UNII of guanethidine sulfate is 5UBY8Y002G.
What is the ChEMBL ID of guanethidine sulfate?
The ChEMBL ID of guanethidine sulfate is CHEMBL1345.