What is the molecular formula of glyceryl behenate?
The molecular formula of glyceryl behenate is C25H50O4.
What is the molecular weight of glyceryl behenate?
The molecular weight of glyceryl behenate is 414.7 g/mol.
What is the IUPAC Name of glyceryl behenate?
The IUPAC Name of glyceryl behenate is 2,3-dihydroxypropyl docosanoate.
What is the InChI of glyceryl behenate?
The InChI of glyceryl behenate is InChI=1S/C25H50O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(28)29-23-24(27)22-26/h24,26-27H,2-23H2,1H3.
What is the InChIKey of glyceryl behenate?
The InChIKey of glyceryl behenate is OKMWKBLSFKFYGZ-UHFFFAOYSA-N.
What is the Canonical SMILES of glyceryl behenate?
The Canonical SMILES of glyceryl behenate is CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(CO)O.
What is the CAS number of glyceryl behenate?
The CAS number of glyceryl behenate is 30233-64-8.
What is the UNII of glyceryl behenate?
The UNII of glyceryl behenate is A626UU0W2A.
What is the XLogP3 value of glyceryl behenate?
The XLogP3 value of glyceryl behenate is 9.6.
What is the hydrogen bond donor count of glyceryl behenate?
The hydrogen bond donor count of glyceryl behenate is 2.