What is the molecular formula of glyceric acid?
The molecular formula of glyceric acid is C3H6O4.
What is the molecular weight of glyceric acid?
The molecular weight of glyceric acid is 106.08 g/mol.
What are the synonyms for glyceric acid?
The synonyms for glyceric acid include DL-Glyceric acid, 2,3-Dihydroxypropanoic acid, and more.
What is the IUPAC name of glyceric acid?
The IUPAC name of glyceric acid is 2,3-dihydroxypropanoic acid.
What is the InChI of glyceric acid?
The InChI of glyceric acid is InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7).
What is the InChIKey of glyceric acid?
The InChIKey of glyceric acid is RBNPOMFGQQGHHO-UHFFFAOYSA-N.
What is the canonical SMILES of glyceric acid?
The canonical SMILES of glyceric acid is C(C(C(=O)O)O)O.
What is the CAS number of glyceric acid?
The CAS number of glyceric acid is 473-81-4.
What is the European Community (EC) number of glyceric acid?
The European Community (EC) number of glyceric acid is 207-472-9.