What is the PubChem CID of Glucotropaeolin?
The PubChem CID of Glucotropaeolin is 656498.
What is the molecular formula of Glucotropaeolin?
The molecular formula of Glucotropaeolin is C14H19NO9S2.
What are some synonyms of Glucotropaeolin?
Some synonyms of Glucotropaeolin are Glucotropeolin, [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-phenyl-N-sulfooxyethanimidothioate, and Benzyl glucosinolate.
What is the molecular weight of Glucotropaeolin?
The molecular weight of Glucotropaeolin is 409.4 g/mol.
What is the IUPAC Name of Glucotropaeolin?
The IUPAC Name of Glucotropaeolin is [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-phenyl-N-sulfooxyethanimidothioate.
What is the InChI of Glucotropaeolin?
The InChI of Glucotropaeolin is InChI=1S/C14H19NO9S2/c16-7-9-11(17)12(18)13(19)14(23-9)25-10(15-24-26(20,21)22)6-8-4-2-1-3-5-8/h1-5,9,11-14,16-19H,6-7H2,(H,20,21,22)/t9-,11-,12+,13-,14+/m1/s1.
What is the InChIKey of Glucotropaeolin?
The InChIKey of Glucotropaeolin is QQGLQYQXUKHWPX-LPUQOGTASA-N.
What is the Canonical SMILES of Glucotropaeolin?
The Canonical SMILES of Glucotropaeolin is C1=CC=C(C=C1)CC(=NOS(=O)(=O)O)SC2C(C(C(C(O2)CO)O)O)O.
What is the CAS number of Glucotropaeolin?
The CAS number of Glucotropaeolin is 499-26-3.