What is the molecular formula of glucopsychosine?
The molecular formula of glucopsychosine is C24H47NO7.
What are the synonyms for glucopsychosine?
The synonyms for glucopsychosine are glucosylsphingosine, D-Glucosylsphingosine, lyso-GlcCer, Lyso GlcCer, and more.
What is the molecular weight of glucopsychosine?
The molecular weight of glucopsychosine is 461.6 g/mol.
When was glucopsychosine created and modified?
Glucopsychosine was created on June 24, 2005, and modified on December 30, 2023.
What is the IUPAC name of glucopsychosine?
The IUPAC name of glucopsychosine is (2R,3R,4S,5S,6R)-2-[(E,2S,3R)-2-amino-3-hydroxyoctadec-4-enoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
What is the InChI of glucopsychosine?
The InChI of glucopsychosine is InChI=1S/C24H47NO7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(27)18(25)17-31-24-23(30)22(29)21(28)20(16-26)32-24/h14-15,18-24,26-30H,2-13,16-17,25H2,1H3/b15-14+/t18-,19+,20+,21+,22-,23+,24+/m0/s1.
What is the InChIKey of glucopsychosine?
The InChIKey of glucopsychosine is HHJTWTPUPVQKNA-JIAPQYILSA-N.
What is the canonical SMILES of glucopsychosine?
The canonical SMILES of glucopsychosine is CCCCCCCCCCCCCC=CC(C(COC1C(C(C(C(O1)CO)O)O)O)N)O.
What is the CAS ID of glucopsychosine?
The CAS ID of glucopsychosine is 52050-17-6.