What is the molecular formula of Glisoxepide?
The molecular formula of Glisoxepide is C20H27N5O5S.
What is the molecular weight of Glisoxepide?
The molecular weight of Glisoxepide is 449.5 g/mol.
What is the IUPAC name of Glisoxepide?
The IUPAC name of Glisoxepide is N-[2-[4-(azepan-1-ylcarbamoylsulfamoyl)phenyl]ethyl]-5-methyl-1,2-oxazole-3-carboxamide.
What is the InChI key of Glisoxepide?
The InChI key of Glisoxepide is ZKUDBRCEOBOWLF-UHFFFAOYSA-N.
What is the canonical SMILES representation of Glisoxepide?
The canonical SMILES representation of Glisoxepide is CC1=CC(=NO1)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)NN3CCCCCC3.
What is the CAS number of Glisoxepide?
The CAS number of Glisoxepide is 25046-79-1.
What is the European Community (EC) number of Glisoxepide?
The European Community (EC) number of Glisoxepide is 246-579-5.
What is the DrugBank ID of Glisoxepide?
The DrugBank ID of Glisoxepide is CHEMBL2106618.
What is the XLogP3-AA value of Glisoxepide?
The XLogP3-AA value of Glisoxepide is 2.9.
How is Glisoxepide excreted from the body?
Glisoxepide is excreted in both the bile and urine.