What is the molecular formula of GHB(RG)?
The molecular formula of GHB(RG) is C11H14N2O4.
What is the molecular weight of GHB(RG)?
The molecular weight of GHB(RG) is 238.24 g/mol.
What is the IUPAC name of GHB(RG)?
The IUPAC name of GHB(RG) is (2S)-2-amino-5-(4-hydroxyanilino)-5-oxopentanoic acid.
What is the InChI of GHB(RG)?
The InChI of GHB(RG) is InChI=1S/C11H14N2O4/c12-9(11(16)17)5-6-10(15)13-7-1-3-8(14)4-2-7/h1-4,9,14H,5-6,12H2,(H,13,15)(H,16,17)/t9-/m0/s1.
What is the InChIKey of GHB(RG)?
The InChIKey of GHB(RG) is LOTUEIYQWILGCV-VIFPVBQESA-N.
What is the canonical SMILES of GHB(RG)?
The canonical SMILES of GHB(RG) is C1=CC(=CC=C1NC(=O)CCC(C(=O)O)N)O.
What is the isomeric SMILES of GHB(RG)?
The isomeric SMILES of GHB(RG) is C1=CC(=CC=C1NC(=O)CC[C@@H](C(=O)O)N)O.
What is the CAS number of GHB(RG)?
The CAS number of GHB(RG) is 30382-24-2.
What is the ChEMBL ID of GHB(RG)?
The ChEMBL ID of GHB(RG) is CHEMBL3244471.
What is the molecular weight, XLogP3-AA, hydrogen bond donor count, hydrogen bond acceptor count, and rotatable bond count of GHB(RG)?
The molecular weight of GHB(RG) is 238.24 g/mol.
The XLogP3-AA of GHB(RG) is -2.6.
The hydrogen bond donor count of GHB(RG) is 4.
The hydrogen bond acceptor count of GHB(RG) is 5.
The rotatable bond count of GHB(RG) is 5.