What is the PubChem CID of genistein?
The PubChem CID of genistein is 5280961.
What is the molecular formula of genistein?
The molecular formula of genistein is C15H10O5.
What are the synonyms of genistein?
The synonyms of genistein include genistein, Prunetol, 4',5,7-Trihydroxyisoflavone, and Genisterin.
What is the molecular weight of genistein?
The molecular weight of genistein is 270.24 g/mol.
What is the IUPAC name of genistein?
The IUPAC name of genistein is 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one.
What is the InChI of genistein?
The InChI of genistein is InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,16-18H.
What is the InChIKey of genistein?
The InChIKey of genistein is TZBJGXHYKVUXJN-UHFFFAOYSA-N.
What is the canonical SMILES of genistein?
The canonical SMILES of genistein is C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O.
What is the CAS number of genistein?
The CAS number of genistein is 446-72-0.
What are the natural sources of genistein?
The natural sources of genistein include tofu, fava beans, soybeans, kudzu, and lupin.