What is the molecular formula of Gefitinib?
The molecular formula of Gefitinib is C22H24ClFN4O3.
What is the molecular weight of Gefitinib?
The molecular weight of Gefitinib is 446.9 g/mol.
What is the description of Gefitinib?
Gefitinib is a member of the class of quinazolines that is used as an EGFR kinase inhibitor for the treatment of non-small cell lung cancer.
What are some synonyms for Gefitinib?
Some synonyms for Gefitinib include Iressa, ZD1839, and Irressat.
What is the mechanism of action of Gefitinib?
The mechanism of action of Gefitinib is as a Protein Kinase Inhibitor.
What is the IUPAC name of Gefitinib?
The IUPAC name of Gefitinib is N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine.
What is the InChIKey of Gefitinib?
The InChIKey of Gefitinib is XGALLCVXEZPNRQ-UHFFFAOYSA-N.
What is the canonical SMILES representation of Gefitinib?
The canonical SMILES representation of Gefitinib is COC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)Cl)OCCCN4CCOCC4.
What identifiers are associated with Gefitinib?
Some identifiers associated with Gefitinib include CAS number 184475-35-2, ChEMBL ID CHEMBL939, and KEGG ID D01977.
How is Gefitinib described in terms of computed properties?
Gefitinib has a molecular weight of 446.9 g/mol, an XLogP3-AA value of 4.1, one hydrogen bond donor count, and eight hydrogen bond acceptor count according to computed properties.