What is the PubChem CID of Furacilin?
The PubChem CID of Furacilin is 5447130.
What is the molecular formula of Furacilin?
The molecular formula of Furacilin is C6H6N4O4.
What are the synonyms of Furacilin?
The synonyms of Furacilin are nitrofurazone, 59-87-0, Nitrofural, Furacin.
What is the molecular weight of Furacilin?
The molecular weight of Furacilin is 198.14 g/mol.
When was Furacilin created?
Furacilin was created on July 10, 2005.
When was Furacilin last modified?
Furacilin was last modified on December 30, 2023.
What is the IUPAC name of Furacilin?
The IUPAC name of Furacilin is [(E)-(5-nitrofuran-2-yl)methylideneamino]urea.
What is the InChI of Furacilin?
The InChI of Furacilin is InChI=1S/C6H6N4O4/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13/h1-3H,(H3,7,9,11)/b8-3+.
What is the canonical SMILES of Furacilin?
The canonical SMILES of Furacilin is C1=C(OC(=C1)[N+](=O)[O-])C=NNC(=O)N.
What is the CAS number of Furacilin?
The CAS number of Furacilin is 59-87-0.