What is the molecular formula of Forodesine?
The molecular formula of Forodesine is C11H14N4O4.
What are the synonyms of Forodesine?
The synonyms of Forodesine are Immucillin H, Fodosine, and Immucillin-H.
What is the molecular weight of Forodesine?
The molecular weight of Forodesine is 266.25 g/mol.
What is the description of Forodesine?
Forodesine is described as a highly potent, orally active, rationally designed PNP inhibitor that has shown activity in preclinical studies with malignant cells and clinical utility against T-cell acute lymphoblastic leukemia and cutaneous T-cell lymphoma.
What is the IUPAC name of Forodesine?
The IUPAC name of Forodesine is 7-[(2S,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidin-2-yl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
What is the InChI of Forodesine?
The InChI of Forodesine is InChI=1S/C11H14N4O4/c16-2-5-9(17)10(18)7(15-5)4-1-12-8-6(4)13-3-14-11(8)19/h1,3,5,7,9-10,12,15-18H,2H2,(H,13,14,19)/t5-,7+,9-,10+/m1/s1.
What is the InChIKey of Forodesine?
The InChIKey of Forodesine is IWKXDMQDITUYRK-KUBHLMPHSA-N.
What is the canonical SMILES of Forodesine?
The canonical SMILES of Forodesine is C1=C(C2=C(N1)C(=O)NC=N2)C3C(C(C(N3)CO)O)O.
What is the CAS number of Forodesine?
The CAS number of Forodesine is 209799-67-7.
What is the NCI Thesaurus Code of Forodesine?
The NCI Thesaurus Code of Forodesine is C65755.