What is the PubChem CID for Formosulfathiazole?
The PubChem CID for Formosulfathiazole is 5340.
What is the molecular formula of Formosulfathiazole?
The molecular formula of Formosulfathiazole is C9H9N3O2S2.
What is the molecular weight of Formosulfathiazole?
The molecular weight of Formosulfathiazole is 255.3 g/mol.
Is Formosulfathiazole soluble in water?
No, Formosulfathiazole is insoluble in water.
What is the IUPAC name of Formosulfathiazole?
The IUPAC name of Formosulfathiazole is 4-amino-N-(1,3-thiazol-2-yl)benzenesulfonamide.
What is the InChIKey of Formosulfathiazole?
The InChIKey of Formosulfathiazole is JNMRHUJNCSQMMB-UHFFFAOYSA-N.
What is the Canonical SMILES of Formosulfathiazole?
The Canonical SMILES of Formosulfathiazole is C1=CC(=CC=C1N)S(=O)(=O)NC2=NC=CS2.
What is the CAS number of Formosulfathiazole?
The CAS number of Formosulfathiazole is 72-14-0.
What is the UNII of Formosulfathiazole?
The UNII of Formosulfathiazole is Y7FKS2XWQH.
What is the ChEMBL ID of Formosulfathiazole?
The ChEMBL ID of Formosulfathiazole is CHEMBL437.