What is the molecular formula of Fmoc-Trp(Boc)-OH?
The molecular formula of Fmoc-Trp(Boc)-OH is C31H30N2O6.
What is the molecular weight of Fmoc-Trp(Boc)-OH?
The molecular weight of Fmoc-Trp(Boc)-OH is 526.6 g/mol.
What is the IUPAC name of Fmoc-Trp(Boc)-OH?
The IUPAC name of Fmoc-Trp(Boc)-OH is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid.
What is the InChI of Fmoc-Trp(Boc)-OH?
The InChI of Fmoc-Trp(Boc)-OH is InChI=1S/C31H30N2O6/c1-31(2,3)39-30(37)33-17-19(20-10-8-9-15-27(20)33)16-26(28(34)35)32-29(36)38-18-25-23-13-6-4-11-21(23)22-12-5-7-14-24(22)25/h4-15,17,25-26H,16,18H2,1-3H3,(H,32,36)(H,34,35)/t26-/m0/s1.
What is the Canonical SMILES of Fmoc-Trp(Boc)-OH?
The Canonical SMILES of Fmoc-Trp(Boc)-OH is CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)CC(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35.
What is the CAS number of Fmoc-Trp(Boc)-OH?
The CAS number of Fmoc-Trp(Boc)-OH is 143824-78-6.
What is the XLogP3-AA value of Fmoc-Trp(Boc)-OH?
The XLogP3-AA value of Fmoc-Trp(Boc)-OH is 6.
How many hydrogen bond donor counts does Fmoc-Trp(Boc)-OH have?
Fmoc-Trp(Boc)-OH has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Fmoc-Trp(Boc)-OH have?
Fmoc-Trp(Boc)-OH has 6 hydrogen bond acceptor counts.
How many rotatable bond counts does Fmoc-Trp(Boc)-OH have?
Fmoc-Trp(Boc)-OH has 9 rotatable bond counts.