What is the molecular formula of Fmoc-s-trityl-L-penicillamine?
The molecular formula of Fmoc-s-trityl-L-penicillamine is C39H35NO4S.
What are some synonyms for Fmoc-s-trityl-L-penicillamine?
Some synonyms for Fmoc-s-trityl-L-penicillamine are Fmoc-Pen(Trt)-OH, 201531-88-6, and (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methyl-3-(tritylthio)butanoic acid.
What is the molecular weight of Fmoc-s-trityl-L-penicillamine?
The molecular weight of Fmoc-s-trityl-L-penicillamine is 613.8 g/mol.
What is the IUPAC name of Fmoc-s-trityl-L-penicillamine?
The IUPAC name of Fmoc-s-trityl-L-penicillamine is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-tritylsulfanylbutanoic acid.
What is the InChIKey of Fmoc-s-trityl-L-penicillamine?
The InChIKey of Fmoc-s-trityl-L-penicillamine is XSGMGAINOILNJR-PGUFJCEWSA-N.
What is the Canonical SMILES of Fmoc-s-trityl-L-penicillamine?
The Canonical SMILES of Fmoc-s-trityl-L-penicillamine is CC(C)(C(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)SC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6.
What is the CAS number of Fmoc-s-trityl-L-penicillamine?
The CAS number of Fmoc-s-trityl-L-penicillamine is 201531-88-6.
How many hydrogen bond donor counts are there in Fmoc-s-trityl-L-penicillamine?
There are 2 hydrogen bond donor counts in Fmoc-s-trityl-L-penicillamine.
What is the XLogP3-AA value of Fmoc-s-trityl-L-penicillamine?
The XLogP3-AA value of Fmoc-s-trityl-L-penicillamine is 8.6.
What is the topological polar surface area of Fmoc-s-trityl-L-penicillamine?
The topological polar surface area of Fmoc-s-trityl-L-penicillamine is 101.2.
※ Please kindly note that our products are for research use only.