What is the molecular formula of Fmoc-(R)-3-amino-3-(2-hydroxy-phenyl)-propionic acid?
The molecular formula is C24H21NO5.
What is the PubChem CID of Fmoc-(R)-3-amino-3-(2-hydroxy-phenyl)-propionic acid?
The PubChem CID is 2761765.
What is the IUPAC name of Fmoc-(R)-3-amino-3-(2-hydroxy-phenyl)-propionic acid?
The IUPAC name is (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxyphenyl)propanoic acid.
What is the InChI of Fmoc-(R)-3-amino-3-(2-hydroxy-phenyl)-propionic acid?
The InChI is InChI=1S/C24H21NO5/c26-22-12-6-5-11-19(22)21(13-23(27)28)25-24(29)30-14-20-17-9-3-1-7-15(17)16-8-2-4-10-18(16)20/h1-12,20-21,26H,13-14H2,(H,25,29)(H,27,28)/t21-/m1/s1.
What is the InChIKey of Fmoc-(R)-3-amino-3-(2-hydroxy-phenyl)-propionic acid?
The InChIKey is JYMPQFLSLFTILZ-OAQYLSRUSA-N.
What is the canonical SMILES of Fmoc-(R)-3-amino-3-(2-hydroxy-phenyl)-propionic acid?
The canonical SMILES is C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C4=CC=CC=C4O.
What is the molecular weight of Fmoc-(R)-3-amino-3-(2-hydroxy-phenyl)-propionic acid?
The molecular weight is 403.4 g/mol.
How many hydrogen bond donor counts are there in Fmoc-(R)-3-amino-3-(2-hydroxy-phenyl)-propionic acid?
There are 3 hydrogen bond donor counts.
What is the XLogP3-AA value of Fmoc-(R)-3-amino-3-(2-hydroxy-phenyl)-propionic acid?
The XLogP3-AA value is 4.3.
Is Fmoc-(R)-3-amino-3-(2-hydroxy-phenyl)-propionic acid canonicalized as a compound?
Yes, Fmoc-(R)-3-amino-3-(2-hydroxy-phenyl)-propionic acid is canonicalized as a compound.
※ Please kindly note that our products are for research use only.