What is the molecular formula of Fmoc-L-leucine?
The molecular formula of Fmoc-L-leucine is C21H23NO4.
What is the molecular weight of Fmoc-L-leucine?
The molecular weight of Fmoc-L-leucine is 353.4 g/mol.
What is the IUPAC name of Fmoc-L-leucine?
The IUPAC name of Fmoc-L-leucine is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoic acid.
What is the Canonical SMILES of Fmoc-L-leucine?
The Canonical SMILES of Fmoc-L-leucine is CC(C)CC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13.
What is the InChIKey of Fmoc-L-leucine?
The InChIKey of Fmoc-L-leucine is CBPJQFCAFFNICX-IBGZPJMESA-N.
How many hydrogen bond donor counts are there in Fmoc-L-leucine?
There are 2 hydrogen bond donor counts in Fmoc-L-leucine.
What is the XLogP3-AA value of Fmoc-L-leucine?
The XLogP3-AA value of Fmoc-L-leucine is 4.4.
What is the topological polar surface area of Fmoc-L-leucine?
The topological polar surface area of Fmoc-L-leucine is 75.6 Ų.
How many rotatable bond counts are there in Fmoc-L-leucine?
There are 7 rotatable bond counts in Fmoc-L-leucine.
What is the complexity value of Fmoc-L-leucine?
The complexity value of Fmoc-L-leucine is 484.