What is the molecular formula of Fmoc-ala-aldehyde?
The molecular formula of Fmoc-ala-aldehyde is C18H17NO3.
What are the synonyms for Fmoc-ala-aldehyde?
The synonyms for Fmoc-ala-aldehyde include Fmoc-alanine aldehyde, (S)-(9H-Fluoren-9-yl)methyl (1-oxopropan-2-yl)carbamate, 9H-fluoren-9-ylmethyl N-[(2S)-1-oxopropan-2-yl]carbamate, and Fmoc-Ala-Wang resin.
What is the molecular weight of Fmoc-ala-aldehyde?
The molecular weight of Fmoc-ala-aldehyde is 295.3 g/mol.
What is the IUPAC name of Fmoc-ala-aldehyde?
The IUPAC name of Fmoc-ala-aldehyde is 9H-fluoren-9-ylmethyl N-[(2S)-1-oxopropan-2-yl]carbamate.
What is the InChI of Fmoc-ala-aldehyde?
The InChI of Fmoc-ala-aldehyde is InChI=1S/C18H17NO3/c1-12(10-20)19-18(21)22-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-10,12,17H,11H2,1H3,(H,19,21)/t12-/m0/s1.
What is the InChIKey of Fmoc-ala-aldehyde?
The InChIKey of Fmoc-ala-aldehyde is LJGFXAKKZLFEDR-LBPRGKRZSA-N.
What is the canonical SMILES of Fmoc-ala-aldehyde?
The canonical SMILES of Fmoc-ala-aldehyde is CC(C=O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13.
What is the XLogP3-AA value of Fmoc-ala-aldehyde?
The XLogP3-AA value of Fmoc-ala-aldehyde is 3.
How many hydrogen bond donor count does Fmoc-ala-aldehyde have?
Fmoc-ala-aldehyde has 1 hydrogen bond donor count.
How many rotatable bond count does Fmoc-ala-aldehyde have?
Fmoc-ala-aldehyde has 5 rotatable bond counts.